CAS 135159-25-0 appears in our catalog under these names: 2,4,6-Trimethoxyphenylboronic acid/ 95+%, 2,4,6-Trimethoxyphenylboronic acid, 98%, 2,4,6-Trimethoxyphenylboronic acid, 95-<97%, 2,4,6-Trimethoxyphenylboronic acid, ≥97-<99%, 2,4,6-Trimethoxybenzeneboronic acid, 98% . Offered by: Chemat, Combi-blocks, Hoffman Fine Chemicals, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100g, 200g, 300g.
(2,4,6-trimethoxyphenyl)boronic acid (CAS 135159-25-0) is a chemical compound with the molecular formula C9H13BO5 and a molecular weight of 212.01 g/mol. IUPAC name: (2,4,6-trimethoxyphenyl)boronic acid. InChIKey: PKLRXZVPEQJTTJ-UHFFFAOYSA-N.
| Molecular formula | C9H13BO5 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | (2,4,6-trimethoxyphenyl)boronic acid |
| InChIKey | PKLRXZVPEQJTTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)OC)OC)(O)O |
Computed by PubChem (NCBI)