cas: 864292-37-5 — see every product listed under this CAS number, including other names
2,4-DICHLORO-7-FLUORO-6-METHOXY-QUINAZOLINE, 97% (CAS 864292-37-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467300-100MG |
| cas | 864292-37-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1257.91 Pln | |
| Fluorochem | 250mg | 2059.71 Pln | |
| Fluorochem | 500mg | 3215.55 Pln | |
| Fluorochem | 1g | 3949.67 Pln | |
| Fluorochem | 5g | 11795.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dichloro-7-fluoro-6-methoxyquinazoline (CAS 864292-37-5) is a chemical compound with the molecular formula C9H5Cl2FN2O and a molecular weight of 247.05 g/mol. IUPAC name: 2,4-dichloro-7-fluoro-6-methoxyquinazoline. InChIKey: GDHHZQMPTVSQOJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2FN2O |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2,4-dichloro-7-fluoro-6-methoxyquinazoline |
| InChIKey | GDHHZQMPTVSQOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)Cl)Cl)F |
Computed by PubChem (NCBI)