CAS 851983-50-1 is the registry number for 2-(4-Chloro-2-fluorophenyl)-5-(chloromethyl)-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-(4-chloro-2-fluorophenyl)-5-(chloromethyl)-1,3,4-oxadiazole (CAS 851983-50-1) is a chemical compound with the molecular formula C9H5Cl2FN2O and a molecular weight of 247.05 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenyl)-5-(chloromethyl)-1,3,4-oxadiazole. InChIKey: KOUMFDONMQMDRD-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2FN2O |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenyl)-5-(chloromethyl)-1,3,4-oxadiazole |
| InChIKey | KOUMFDONMQMDRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)