cas: 873055-57-3 — see every product listed under this CAS number, including other names
2,4-Di-tert-butyl-5-nitrophenol 98% (CAS 873055-57-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A285897-250mg |
| cas | 873055-57-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2372.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A285897 |
2,4-ditert-butyl-5-nitrophenol (CAS 873055-57-3) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: 2,4-ditert-butyl-5-nitrophenol. InChIKey: VIWYWRSFQRIVPI-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | 2,4-ditert-butyl-5-nitrophenol |
| InChIKey | VIWYWRSFQRIVPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1[N+](=O)[O-])O)C(C)(C)C |
Computed by PubChem (NCBI)