Products 75667-93-5
CAS 75667-93-5 appears in our catalog under these names: 3-Acetylamino-1-adamantane acetic acid, 95%, 3-Acetylamino-1-adamantane acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2g, 5g, 10g.
2-(3-acetamido-1-adamantyl)acetic acid (CAS 75667-93-5) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: 2-(3-acetamido-1-adamantyl)acetic acid. InChIKey: WGQQQEFRSGVMSR-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | 2-(3-acetamido-1-adamantyl)acetic acid |
| InChIKey | WGQQQEFRSGVMSR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C3)(C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(3-Acetamidoadamantan-1-yl)acetic acid, 3-acetylamino-1-adamantaneacetic acid, 2-(3-acetamido-1-adamantyl)acetic acid, (3-Acetylamino-adamantan-1-yl)-acetic acid, (3-acetamidoadamantan-1-yl)acetic acid, Oprea1_361228, IFLab1_001755, 2-(3-Acetamidoadamantan-1-yl)aceticacid, (3-Acetamidotricyclo[3.3.1.1~3,7~]decan-1-yl)acetic acid