cas: 121263-10-3 — see every product listed under this CAS number, including other names
2,4-Dibromo-3-nitropyridine, 97% (CAS 121263-10-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A506555-250mg |
| cas | 121263-10-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1085.56 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 2106.57 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dibromo-3-nitropyridine (CAS 121263-10-3) is a chemical compound with the molecular formula C5H2Br2N2O2 and a molecular weight of 281.89 g/mol. IUPAC name: 2,4-dibromo-3-nitropyridine. InChIKey: JGJXIUCFDVHTST-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O2 |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | 2,4-dibromo-3-nitropyridine |
| InChIKey | JGJXIUCFDVHTST-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)