CAS 121263-10-3 appears in our catalog under these names: 2,4–Dibromo–3–nitropyridine, 2,4-Dibromo-3-nitropyridine, 95%, 2,4-Dibromo-3-nitropyridine, 97%, 2,4-Dibromo-3-nitropyridine, 95%, 95%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
2,4-dibromo-3-nitropyridine (CAS 121263-10-3) is a chemical compound with the molecular formula C5H2Br2N2O2 and a molecular weight of 281.89 g/mol. IUPAC name: 2,4-dibromo-3-nitropyridine. InChIKey: JGJXIUCFDVHTST-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O2 |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | 2,4-dibromo-3-nitropyridine |
| InChIKey | JGJXIUCFDVHTST-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)