cas: 1214365-67-9 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-(trifluoromethyl)pyridin-3-amine, 97%, 97% (CAS 1214365-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125WL-100mg |
| cas | 1214365-67-9 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dibromo-6-(trifluoromethyl)pyridin-3-amine (CAS 1214365-67-9) is a chemical compound with the molecular formula C6H3Br2F3N2 and a molecular weight of 319.90 g/mol. IUPAC name: 2,4-dibromo-6-(trifluoromethyl)pyridin-3-amine. InChIKey: HNWHGPNRZQMGRA-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F3N2 |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 2,4-dibromo-6-(trifluoromethyl)pyridin-3-amine |
| InChIKey | HNWHGPNRZQMGRA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1C(F)(F)F)Br)N)Br |
Computed by PubChem (NCBI)