CAS 1291487-16-5 appears in our catalog under these names: 2-Amino-3,5-dibromo-6-trifluoropyridine, 95%, 3,5-Dibromo-6-(trifluoromethyl)pyridin-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
3,5-dibromo-6-(trifluoromethyl)pyridin-2-amine (CAS 1291487-16-5) is a chemical compound with the molecular formula C6H3Br2F3N2 and a molecular weight of 319.90 g/mol. IUPAC name: 3,5-dibromo-6-(trifluoromethyl)pyridin-2-amine. InChIKey: HMBKQISYTKFUPE-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F3N2 |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 3,5-dibromo-6-(trifluoromethyl)pyridin-2-amine |
| InChIKey | HMBKQISYTKFUPE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Br)N)C(F)(F)F)Br |
Computed by PubChem (NCBI)