cas: 1060815-86-2 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-methyl-7H-pyrrolo[2,3-d]pyrimidine 97% (CAS 1060815-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A846703-100mg |
| cas | 1060815-86-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 904.38 Pln | |
| Ambeed | 1g | 2361.75 Pln | |
| Ambeed | 5g | 6995.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A846703 |
2,4-dichloro-5-methyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 1060815-86-2) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 2,4-dichloro-5-methyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: YXPYVRKJOFGHQI-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 2,4-dichloro-5-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | YXPYVRKJOFGHQI-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)