Products 120422-90-4
CAS 120422-90-4 appears in our catalog under these names: 4,6-Dichloro-3-methyl-1h-pyrazolo[4,3-c]pyridine, 95%, 4，6–Dichloro–3–methyl–1H–pyrazolo(4，3–c)pyridine. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
4,6-dichloro-3-methyl-2H-pyrazolo[4,3-c]pyridine (CAS 120422-90-4) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4,6-dichloro-3-methyl-2H-pyrazolo[4,3-c]pyridine. InChIKey: OEDSJFVMMHLPBB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | OEDSJFVMMHLPBB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1)C=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)