2,4-Dichloro-6-(trifluoromethyl)pyridine
cas: 39891-02-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-(trifluoromethyl)pyridine (CAS 39891-02-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224920-1G |
| cas | 39891-02-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 924.69 Pln | |
| Fluorochem | 25g | 2174.25 Pln |
properties
| delivery time | 1-2 weeks |
|---|
2,4-dichloro-6-(trifluoromethyl)pyridine (CAS 39891-02-6) is a chemical compound with the molecular formula C6H2Cl2F3N and a molecular weight of 215.98 g/mol. IUPAC name: 2,4-dichloro-6-(trifluoromethyl)pyridine. InChIKey: BJHUMUZOLTXVSC-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F3N |
|---|---|
| Molecular weight | 215.98 g/mol |
| IUPAC name | 2,4-dichloro-6-(trifluoromethyl)pyridine |
| InChIKey | BJHUMUZOLTXVSC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)