CAS 89719-93-7 appears in our catalog under these names: 2,3-Dichloro-4-(trifluoromethyl)pyridine, 98%, 2,3–Dichloro–4–(trifluoromethyl)pyridine, 2,3-Dichloro-4-(trifluoromethyl)pyridine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 500mg, 1g, 250mg, 5g, 0,5g.
2,3-dichloro-4-(trifluoromethyl)pyridine (CAS 89719-93-7) is a chemical compound with the molecular formula C6H2Cl2F3N and a molecular weight of 215.98 g/mol. IUPAC name: 2,3-dichloro-4-(trifluoromethyl)pyridine. InChIKey: ZFCZNQZILNNPBH-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F3N |
|---|---|
| Molecular weight | 215.98 g/mol |
| IUPAC name | 2,3-dichloro-4-(trifluoromethyl)pyridine |
| InChIKey | ZFCZNQZILNNPBH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)