cas: 87475-64-7 — see every product listed under this CAS number, including other names
2,4-Dichlorobenzenesulfonylacetonitrile (CAS 87475-64-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011136-250MG |
| cas | 87475-64-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 2g | 924.69 Pln | |
| Fluorochem | 5g | 1799.38 Pln |
| delivery time | 2-3 weeks |
|---|
2-(2,4-dichlorophenyl)sulfonylacetonitrile (CAS 87475-64-7) is a chemical compound with the molecular formula C8H5Cl2NO2S and a molecular weight of 250.10 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)sulfonylacetonitrile. InChIKey: RIJAUKHQIOCSTA-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO2S |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)sulfonylacetonitrile |
| InChIKey | RIJAUKHQIOCSTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)CC#N |
Computed by PubChem (NCBI)