CAS 691887-83-9 appears in our catalog under these names: (2,5-Dichloro-benzenesulfonyl)-acetonitrile, 95%, 2-((2,5-Dichlorophenyl)sulfonyl)ethanenitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
2-(2,5-dichlorophenyl)sulfonylacetonitrile (CAS 691887-83-9) is a chemical compound with the molecular formula C8H5Cl2NO2S and a molecular weight of 250.10 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)sulfonylacetonitrile. InChIKey: IRJNWLRPOROPQA-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO2S |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)sulfonylacetonitrile |
| InChIKey | IRJNWLRPOROPQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)CC#N)Cl |
Computed by PubChem (NCBI)