cas: 127228-77-7 — see every product listed under this CAS number, including other names
2,4-Difluoro-5-nitrobenzaldehyde, 98%, 98% (CAS 127228-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120GEG-100mg |
| cas | 127228-77-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1115.60 Pln | |
| Chemat | 5g | 3227.60 Pln | |
| Chemat | 10g | 5349.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-difluoro-5-nitrobenzaldehyde (CAS 127228-77-7) is a chemical compound with the molecular formula C7H3F2NO3 and a molecular weight of 187.10 g/mol. IUPAC name: 2,4-difluoro-5-nitrobenzaldehyde. InChIKey: MMFFDMRGDWUXDH-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO3 |
|---|---|
| Molecular weight | 187.10 g/mol |
| IUPAC name | 2,4-difluoro-5-nitrobenzaldehyde |
| InChIKey | MMFFDMRGDWUXDH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)C=O |
Computed by PubChem (NCBI)