CAS 1803729-97-6 appears in our catalog under these names: 2,3-Difluoro-4-nitrobenzaldehyde, 97%, 2,3-difluoro-4-nitrobenzaldehyde, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2,3-difluoro-4-nitrobenzaldehyde (CAS 1803729-97-6) is a chemical compound with the molecular formula C7H3F2NO3 and a molecular weight of 187.10 g/mol. IUPAC name: 2,3-difluoro-4-nitrobenzaldehyde. InChIKey: RSDAMRUKTYKUFP-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO3 |
|---|---|
| Molecular weight | 187.10 g/mol |
| IUPAC name | 2,3-difluoro-4-nitrobenzaldehyde |
| InChIKey | RSDAMRUKTYKUFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)