cas: 37538-68-4 — see every product listed under this CAS number, including other names
2,4-Dihydroxypyrido[3,2-d]pyrimidine, 97%, 97% (CAS 37538-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLNP-100mg |
| cas | 37538-68-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 530.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1H-pyrido[3,2-d]pyrimidine-2,4-dione (CAS 37538-68-4) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 1H-pyrido[3,2-d]pyrimidine-2,4-dione. InChIKey: BJLUORNGPCXNHM-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| InChIKey | BJLUORNGPCXNHM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)NC(=O)N2)N=C1 |
Computed by PubChem (NCBI)