cas: 37538-68-4 — see every product listed under this CAS number, including other names
Pyrido[3,2-d]pyrimidine-2,4-diol, 97% (CAS 37538-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233615-100MG |
| cas | 37538-68-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 250mg | 487.35 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1H-pyrido[3,2-d]pyrimidine-2,4-dione (CAS 37538-68-4) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 1H-pyrido[3,2-d]pyrimidine-2,4-dione. InChIKey: BJLUORNGPCXNHM-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| InChIKey | BJLUORNGPCXNHM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)NC(=O)N2)N=C1 |
Computed by PubChem (NCBI)