cas: 1074-76-6 — see every product listed under this CAS number, including other names
2,4-Dimethyl-3-nitropyridine, 95% (CAS 1074-76-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068469-5G |
| cas | 1074-76-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 476.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dimethyl-3-nitropyridine (CAS 1074-76-6) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2,4-dimethyl-3-nitropyridine. InChIKey: MOQKFCFVTVIJJS-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2,4-dimethyl-3-nitropyridine |
| InChIKey | MOQKFCFVTVIJJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)