Products 1006959-18-7

CAS 1006959-18-7 is the registry number for (2-Methyl-2H-pyrazol-3-yl)acrylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.

Structural formula: {0} (CAS {1})

(E)-3-(2-methylpyrazol-3-yl)prop-2-enoic acid (CAS 1006959-18-7) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: (E)-3-(2-methylpyrazol-3-yl)prop-2-enoic acid. InChIKey: FLMCGVRZSZMFDQ-NSCUHMNNSA-N.

Identity
Molecular formulaC7H8N2O2
Molecular weight152.15 g/mol
IUPAC name(E)-3-(2-methylpyrazol-3-yl)prop-2-enoic acid
InChIKeyFLMCGVRZSZMFDQ-NSCUHMNNSA-N
SMILESCN1C(=CC=N1)/C=C/C(=O)O

Computed by PubChem (NCBI)