cas: 1635-84-3 — see every product listed under this CAS number, including other names
2,4-Dimethyl-6-nitroaniline 97% (CAS 1635-84-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100473-500g |
| cas | 1635-84-3 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 3151.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 264.69 Pln | |
| Ambeed | 100g | 837.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100473 |
2,4-dimethyl-6-nitroaniline (CAS 1635-84-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,4-dimethyl-6-nitroaniline. InChIKey: VSRYYONYIUUFFY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,4-dimethyl-6-nitroaniline |
| InChIKey | VSRYYONYIUUFFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)