2,4-Dimethylbenzenesulfonic acid dihydrate, 98%
cas: 92558-30-0 — see every product listed under this CAS number, including other names
2,4-Dimethylbenzenesulfonic acid dihydrate, 98% (CAS 92558-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 25g. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1169022-100g |
| cas | 92558-30-0 |
| size | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 181.25 Pln | |
| Ambeed | 500g | 398.19 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 500g | 288.00 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 383.22 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,4-dimethylbenzenesulfonic acid;dihydrate (CAS 92558-30-0) is a chemical compound with the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. IUPAC name: 2,4-dimethylbenzenesulfonic acid;dihydrate. InChIKey: PCMSCWFZBHVERE-UHFFFAOYSA-N.
| Molecular formula | C8H14O5S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 2,4-dimethylbenzenesulfonic acid;dihydrate |
| InChIKey | PCMSCWFZBHVERE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)O)C.O.O |
Computed by PubChem (NCBI)