CAS 633335-73-6 is the registry number for 1-Methanesulfonyloxymethyl-cyclopropanecarboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 1-(methylsulfonyloxymethyl)cyclopropane-1-carboxylate (CAS 633335-73-6) is a chemical compound with the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. IUPAC name: ethyl 1-(methylsulfonyloxymethyl)cyclopropane-1-carboxylate. InChIKey: NAWXPGOSDIZRJJ-UHFFFAOYSA-N.
| Molecular formula | C8H14O5S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | ethyl 1-(methylsulfonyloxymethyl)cyclopropane-1-carboxylate |
| InChIKey | NAWXPGOSDIZRJJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)COS(=O)(=O)C |
Computed by PubChem (NCBI)