Products 633335-73-6

CAS 633335-73-6 is the registry number for 1-Methanesulfonyloxymethyl-cyclopropanecarboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 1-(methylsulfonyloxymethyl)cyclopropane-1-carboxylate (CAS 633335-73-6) is a chemical compound with the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. IUPAC name: ethyl 1-(methylsulfonyloxymethyl)cyclopropane-1-carboxylate. InChIKey: NAWXPGOSDIZRJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O5S
Molecular weight222.26 g/mol
IUPAC nameethyl 1-(methylsulfonyloxymethyl)cyclopropane-1-carboxylate
InChIKeyNAWXPGOSDIZRJJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC1)COS(=O)(=O)C

Computed by PubChem (NCBI)