Products 1771764-64-7
CAS 1771764-64-7 appears in our catalog under these names: 2,5,6,8-Tetramethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, 97%, 97%, 2,5,6,8-Tetramethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2,5,6,8-tetramethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline (CAS 1771764-64-7) is a chemical compound with the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. IUPAC name: 2,5,6,8-tetramethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline. InChIKey: LOKRNFHHPZEJLL-UHFFFAOYSA-N.
| Molecular formula | C16H19NO |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | 2,5,6,8-tetramethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline |
| InChIKey | LOKRNFHHPZEJLL-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C3=C(C=C(C=C3N=C2O1)C)C)C |
Computed by PubChem (NCBI)