CAS 53704-20-4 is the registry number for (3E,5E)-5-(1,3,3-Trimethyl-1,3-dihydro-2h-indol-2-ylidene)pent-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(E,5E)-5-(1,3,3-trimethylindol-2-ylidene)pent-3-en-2-one (CAS 53704-20-4) is a chemical compound with the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. IUPAC name: (E,5E)-5-(1,3,3-trimethylindol-2-ylidene)pent-3-en-2-one. InChIKey: HBKYTZJPJFSCEF-XHBXSBNISA-N.
| Molecular formula | C16H19NO |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | (E,5E)-5-(1,3,3-trimethylindol-2-ylidene)pent-3-en-2-one |
| InChIKey | HBKYTZJPJFSCEF-XHBXSBNISA-N |
| SMILES | CC(=O)/C=C/C=C/1\C(C2=CC=CC=C2N1C)(C)C |
Computed by PubChem (NCBI)