cas: 39267-74-8 — see every product listed under this CAS number, including other names
2,5,6-Triaminopyrimidin-4(3H)-one xsulfate 95% (CAS 39267-74-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A405023-25g |
| cas | 39267-74-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 765.31 Pln | |
| Ambeed | 500g | 2500.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A405023 |
Sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one (CAS 39267-74-8) is a chemical compound with the molecular formula C4H9N5O5S and a molecular weight of 239.21 g/mol. IUPAC name: sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one. InChIKey: RSKNEEODWFLVFF-UHFFFAOYSA-N.
| Molecular formula | C4H9N5O5S |
|---|---|
| Molecular weight | 239.21 g/mol |
| IUPAC name | sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one |
| InChIKey | RSKNEEODWFLVFF-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(NC1=O)N)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)