CAS 39267-74-8 appears in our catalog under these names: 2,5,6-Triaminopyrimidin-4(1h)-one sulphate, 95%, 6-Hydroxy-2,4,5-triaminopyrimidine sulfate, 95%, 2,5,6-Triaminopyrimidin-4(1H)-one Sulphate, Folic Acid Hydrate EP Impurity B (as Sulfate), 2,5,6-Triaminopyrimidin-4(1h)-one sulphate, 95%, 95%. Offered by: Combi-blocks, Mikromol, TRC, Chemat, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 4x25mg, 25mg, 100mg, 10g.
Sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one (CAS 39267-74-8) is a chemical compound with the molecular formula C4H9N5O5S and a molecular weight of 239.21 g/mol. IUPAC name: sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one. InChIKey: RSKNEEODWFLVFF-UHFFFAOYSA-N.
| Molecular formula | C4H9N5O5S |
|---|---|
| Molecular weight | 239.21 g/mol |
| IUPAC name | sulfuric acid;2,4,5-triamino-1H-pyrimidin-6-one |
| InChIKey | RSKNEEODWFLVFF-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(NC1=O)N)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)