2,5,8,11,14,17,20,23,26,29,32,35,38-Tridecaoxahentetracontan-41-oic acid, 95%
cas: 2170098-33-4 — see every product listed under this CAS number, including other names
2,5,8,11,14,17,20,23,26,29,32,35,38-Tridecaoxahentetracontan-41-oic acid, 95% (CAS 2170098-33-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F667943-250MG |
| cas | 2170098-33-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1815.00 Pln | |
| Fluorochem | 25g | 8255.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2170098-33-4) is a chemical compound with the molecular formula C28H56O15 and a molecular weight of 632.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RQQVDBLIIIQXET-UHFFFAOYSA-N.
| Molecular formula | C28H56O15 |
|---|---|
| Molecular weight | 632.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RQQVDBLIIIQXET-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)