cas: 2170098-33-4 — see every product listed under this CAS number, including other names
mPEG12-CH2CH2COOH, 95%, 95% (CAS 2170098-33-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JLOJ-10g |
| cas | 2170098-33-4 |
| size | 10g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1955.60 Pln | |
| Chemat | 50g | 6266.00 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 25g | 3851.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2170098-33-4) is a chemical compound with the molecular formula C28H56O15 and a molecular weight of 632.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RQQVDBLIIIQXET-UHFFFAOYSA-N.
| Molecular formula | C28H56O15 |
|---|---|
| Molecular weight | 632.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RQQVDBLIIIQXET-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)