2,5,8,11,14,17,20,23-Octaoxahexacosan-26-oic Acid, 98%, 98%
cas: 1093647-41-6 — see every product listed under this CAS number, including other names
2,5,8,11,14,17,20,23-Octaoxahexacosan-26-oic Acid, 98%, 98% (CAS 1093647-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U0G-100mg |
| cas | 1093647-41-6 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3784.40 Pln | |
| Chemat | 100g | 6266.00 Pln | |
| Chemat | 250g | 8915.60 Pln | |
| Chemat | 500g | 16368.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1093647-41-6) is a chemical compound with the molecular formula C18H36O10 and a molecular weight of 412.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: JHUSQXBQANBSDC-UHFFFAOYSA-N.
| Molecular formula | C18H36O10 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | JHUSQXBQANBSDC-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)