CAS 1093647-41-6 appears in our catalog under these names: m–PEG7–CH2CH2COOH, MeO-PEG(8)-COOH, m-dPEG®,-Acid (MW = 412), Amino-dPEG®,24-t-Butyl Ester, 2,5,8,11,14,17,20,23-Octaoxahexacosan-26-oic Acid, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 1000mg, 250mg, 5g, 10g, 25g, 50g.
3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1093647-41-6) is a chemical compound with the molecular formula C18H36O10 and a molecular weight of 412.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: JHUSQXBQANBSDC-UHFFFAOYSA-N.
| Molecular formula | C18H36O10 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | JHUSQXBQANBSDC-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)