2,5,8,11,14,17,20,23-Octaoxapentacosan-25-yl acrylate, 95%
cas: 681819-08-9 — see every product listed under this CAS number, including other names
2,5,8,11,14,17,20,23-Octaoxapentacosan-25-yl acrylate, 95% (CAS 681819-08-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2272701-50mg |
| cas | 681819-08-9 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 359.25 Pln | |
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 954.44 Pln | |
| Ambeed | 1g | 2612.06 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1888.40 Pln | |
| BLDpharm | 50mg | 386.56 Pln | |
| BLDpharm | 100mg | 525.40 Pln | |
| BLDpharm | 250mg | 1025.22 Pln | |
| BLDpharm | 1g | 2807.92 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate (CAS 681819-08-9) is a chemical compound with the molecular formula C20H38O10 and a molecular weight of 438.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate. InChIKey: IZYMUBDSFLVSPA-UHFFFAOYSA-N.
| Molecular formula | C20H38O10 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| InChIKey | IZYMUBDSFLVSPA-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOC(=O)C=C |
Computed by PubChem (NCBI)