CAS 2093153-84-3 appears in our catalog under these names: Acid-peg6-t-butyl ester, 95%, Acid–PEG6–C2–Boc, Acid-peg6-t-butyl ester 95%, Acid-peg6-t-butyl ester, 97%, 97%, Acid-PEG6-C2-Boc, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 250 mg, 500 mg, 50 mg.
3-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2093153-84-3) is a chemical compound with the molecular formula C20H38O10 and a molecular weight of 438.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: HHEKCKLYBRNNLN-UHFFFAOYSA-N.
| Molecular formula | C20H38O10 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | HHEKCKLYBRNNLN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)