cas: 20857-44-7 — see every product listed under this CAS number, including other names
2,5-Bis(trifluoromethyl)pyridine, 99% (CAS 20857-44-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036059-1G |
| cas | 20857-44-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2913.58 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
2,5-bis(trifluoromethyl)pyridine (CAS 20857-44-7) is a chemical compound with the molecular formula C7H3F6N and a molecular weight of 215.10 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)pyridine. InChIKey: TWVOBLWLJDHPLH-UHFFFAOYSA-N.
| Molecular formula | C7H3F6N |
|---|---|
| Molecular weight | 215.10 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)pyridine |
| InChIKey | TWVOBLWLJDHPLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)