Products 1713163-12-2
CAS 1713163-12-2 is the registry number for 2-Fluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine (CAS 1713163-12-2) is a chemical compound with the molecular formula C7H3F6N and a molecular weight of 215.10 g/mol. IUPAC name: 2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine. InChIKey: KXASSQNNLRATLP-UHFFFAOYSA-N.
| Molecular formula | C7H3F6N |
|---|---|
| Molecular weight | 215.10 g/mol |
| IUPAC name | 2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)pyridine |
| InChIKey | KXASSQNNLRATLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)F)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)