cas: 1208081-36-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-pyridine-3-sulfonyl chloride, 97% (CAS 1208081-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F070704-100MG |
| cas | 1208081-36-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 2137.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,5-dichloropyridine-3-sulfonyl chloride (CAS 1208081-36-0) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 2,5-dichloropyridine-3-sulfonyl chloride. InChIKey: WVMVRXXYNPDVBK-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 2,5-dichloropyridine-3-sulfonyl chloride |
| InChIKey | WVMVRXXYNPDVBK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)