cas: 1208081-36-0 — see every product listed under this CAS number, including other names
2,5-Dichloropyridine-3-sulfonyl chloride, 97%, 97% (CAS 1208081-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HFS4-100mg |
| cas | 1208081-36-0 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1917.20 Pln | |
| Chemat | 10g | 3314.00 Pln | |
| Chemat | 25g | 6558.80 Pln | |
| Chemat | 100g | 18630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5-dichloropyridine-3-sulfonyl chloride (CAS 1208081-36-0) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 2,5-dichloropyridine-3-sulfonyl chloride. InChIKey: WVMVRXXYNPDVBK-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 2,5-dichloropyridine-3-sulfonyl chloride |
| InChIKey | WVMVRXXYNPDVBK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1S(=O)(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)