cas: 1483-28-9 — see every product listed under this CAS number, including other names
2,5-Dimethoxybenzenesulfonyl chloride, 97% (CAS 1483-28-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008034-250MG |
| cas | 1483-28-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 450.90 Pln | |
| Fluorochem | 100g | 1632.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,5-dimethoxybenzenesulfonyl chloride (CAS 1483-28-9) is a chemical compound with the molecular formula C8H9ClO4S and a molecular weight of 236.67 g/mol. IUPAC name: 2,5-dimethoxybenzenesulfonyl chloride. InChIKey: SHELADVIRCCTFN-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO4S |
|---|---|
| Molecular weight | 236.67 g/mol |
| IUPAC name | 2,5-dimethoxybenzenesulfonyl chloride |
| InChIKey | SHELADVIRCCTFN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)