Products 63624-28-2

CAS 63624-28-2 appears in our catalog under these names: 2,4-Dimethoxybenzenesulfonyl chloride, 90%, 2,4-Dimethoxybenzene-1-sulfonyl chloride 90%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 500g.

Structural formula: {0} (CAS {1})

2,4-dimethoxybenzenesulfonyl chloride (CAS 63624-28-2) is a chemical compound with the molecular formula C8H9ClO4S and a molecular weight of 236.67 g/mol. IUPAC name: 2,4-dimethoxybenzenesulfonyl chloride. InChIKey: AYGZKRRIULCJKC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO4S
Molecular weight236.67 g/mol
IUPAC name2,4-dimethoxybenzenesulfonyl chloride
InChIKeyAYGZKRRIULCJKC-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)