Products 113366-73-7

CAS 113366-73-7 appears in our catalog under these names: 2,5-Dimethyl-1,3-thiazole-4-carboxylic acid, 95%, 2,5-Dimethylthiazole-4-carboxylic acid, 98+%, 2,5-Dimethylthiazole-4-carboxylic Acid, 2,5-Dimethylthiazole-4-carboxylic acid, 95%, 95%, 2,5-Dimethylthiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, TRC, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg, 2,5g, 50mg.

Structural formula: {0} (CAS {1})

2,5-dimethyl-1,3-thiazole-4-carboxylic acid (CAS 113366-73-7) is a chemical compound with the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. IUPAC name: 2,5-dimethyl-1,3-thiazole-4-carboxylic acid. InChIKey: AFHYBEFNQLGRFV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO2S
Molecular weight157.19 g/mol
IUPAC name2,5-dimethyl-1,3-thiazole-4-carboxylic acid
InChIKeyAFHYBEFNQLGRFV-UHFFFAOYSA-N
SMILESCC1=C(N=C(S1)C)C(=O)O

Computed by PubChem (NCBI)