cas: 148757-94-2 — see every product listed under this CAS number, including other names
2,5-Dioxo-1-pyrrolidinyl 6-Quinolylcarbamate (CAS 148757-94-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547177-10MG |
| cas | 148757-94-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 341.56 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 1g | 2986.47 Pln | |
| Fluorochem | 5g | 13482.77 Pln |
| delivery time | 3-4 weeks |
|---|
(2,5-dioxopyrrolidin-1-yl) N-quinolin-6-ylcarbamate (CAS 148757-94-2) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) N-quinolin-6-ylcarbamate. InChIKey: LINZYZMEBMKKIT-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) N-quinolin-6-ylcarbamate |
| InChIKey | LINZYZMEBMKKIT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)NC2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)