cas: 148757-94-2 — see every product listed under this CAS number, including other names
6-Aminoquinoline N-succinimidyl ester, 90.00% (CAS 148757-94-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM41700E-250mg |
| cas | 148757-94-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 10444.76 Pln | |
| Chemat | 50mg | 3049.39 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 90.00% |
| category | Chemicals |
(2,5-dioxopyrrolidin-1-yl) N-quinolin-6-ylcarbamate (CAS 148757-94-2) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) N-quinolin-6-ylcarbamate. InChIKey: LINZYZMEBMKKIT-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) N-quinolin-6-ylcarbamate |
| InChIKey | LINZYZMEBMKKIT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)NC2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)