CAS 66065-85-8 appears in our catalog under these names: Troc-OSu, N-(2,2,2-Trichloroethoxycarbonyloxy)succinimide, >98.0%(GC)(N), 2,5-Dioxopyrrolidin-1-yl (2,2,2-trichloroethyl) carbonate, 95%. Offered by: Iris Biotech, TCI, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 100g.
(2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate (CAS 66065-85-8) is a chemical compound with the molecular formula C7H6Cl3NO5 and a molecular weight of 290.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate. InChIKey: WBZXNGAFYBGQFE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3NO5 |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate |
| InChIKey | WBZXNGAFYBGQFE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)OCC(Cl)(Cl)Cl |
Computed by PubChem (NCBI)