cas: 874208-94-3 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 2,5,8,11,14-pentaoxaheptadecan-17-oate, 98%, 98% (CAS 874208-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H4AG-100mg |
| cas | 874208-94-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1163.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 874208-94-3) is a chemical compound with the molecular formula C16H27NO9 and a molecular weight of 377.39 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: FMMFVGSOBIANGY-UHFFFAOYSA-N.
| Molecular formula | C16H27NO9 |
|---|---|
| Molecular weight | 377.39 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | FMMFVGSOBIANGY-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)