cas: 874208-94-3 — see every product listed under this CAS number, including other names
m-PEG5-NHS ester, 98% (CAS 874208-94-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554674-50MG |
| cas | 874208-94-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 372.80 Pln | |
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1502.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 874208-94-3) is a chemical compound with the molecular formula C16H27NO9 and a molecular weight of 377.39 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: FMMFVGSOBIANGY-UHFFFAOYSA-N.
| Molecular formula | C16H27NO9 |
|---|---|
| Molecular weight | 377.39 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | FMMFVGSOBIANGY-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)