cas: 321862-17-3 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3',6'-bis(dimethylamino)-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carboxylate, 95%, 95% (CAS 321862-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V47B-250mg |
| cas | 321862-17-3 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 9170.00 Pln | |
| Chemat | 1g | 18270.80 Pln | |
| Chemat | 100mg | 6443.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate (CAS 321862-17-3) is a chemical compound with the molecular formula C29H25N3O7 and a molecular weight of 527.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate. InChIKey: CXYYHBMOVJJZTD-UHFFFAOYSA-N.
| Molecular formula | C29H25N3O7 |
|---|---|
| Molecular weight | 527.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| InChIKey | CXYYHBMOVJJZTD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)ON5C(=O)CCC5=O)C(=O)O3)C6=C(O2)C=C(C=C6)N(C)C |
Computed by PubChem (NCBI)