cas: 321862-17-3 — see every product listed under this CAS number, including other names
TAMRA NHS ester, 5–isomer (CAS 321862-17-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 100mg, 25mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC59090-1 |
| cas | 321862-17-3 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 1135.30 Pln | |
| GLPBio | 100mg | 8212.21 Pln | |
| GLPBio | 25mg | 3101.11 Pln | |
| GLPBio | 5mg | 1790.57 Pln | |
| GLPBio | 50mg | 4968.63 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate (CAS 321862-17-3) is a chemical compound with the molecular formula C29H25N3O7 and a molecular weight of 527.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate. InChIKey: CXYYHBMOVJJZTD-UHFFFAOYSA-N.
| Molecular formula | C29H25N3O7 |
|---|---|
| Molecular weight | 527.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| InChIKey | CXYYHBMOVJJZTD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)ON5C(=O)CCC5=O)C(=O)O3)C6=C(O2)C=C(C=C6)N(C)C |
Computed by PubChem (NCBI)