cas: 1807521-05-6 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)propanoate, 98%, 98% (CAS 1807521-05-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I191-50mg |
| cas | 1807521-05-6 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 213.20 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1658.00 Pln | |
| Chemat | 5g | 6443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoate (CAS 1807521-05-6) is a chemical compound with the molecular formula C24H24N2O7 and a molecular weight of 452.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoate. InChIKey: BGPXUJXGIVJFGP-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O7 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoate |
| InChIKey | BGPXUJXGIVJFGP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)