cas: 1807521-05-6 — see every product listed under this CAS number, including other names
Fmoc-PEG1-CH2CH2-NHS ester, 95% (CAS 1807521-05-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986808-1G |
| cas | 1807521-05-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2424.16 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 659.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoate (CAS 1807521-05-6) is a chemical compound with the molecular formula C24H24N2O7 and a molecular weight of 452.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoate. InChIKey: BGPXUJXGIVJFGP-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O7 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoate |
| InChIKey | BGPXUJXGIVJFGP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)